Ranelic acid

Ranelic acid

Names
IUPAC name 5-(Bis(carboxymethyl)amino)-3-(carboxymethyl)-4-cyano-2-thiophenecarboxylic acid
Systematic IUPAC name 5-[Bis(carboxymethyl)amino]-3-(carboxymethyl)-4-cyanothiophene-2-carboxylic acid[1]
Identifiers
CAS Number	135459-90-4 5459-90-4
3D model (Jmol)	Interactive image Interactive image
ChemSpider	2314551
KEGG	D08467
PubChem	3052774
UNII	K9CCS0RIBT
InChI InChI=1S/C12H10N2O8S/c13-2-6-5(1-7(15)16)10(12(21)22)23-11(6)14(3-8(17)18)4-9(19)20/h1,3-4H2,(H,15,16)(H,17,18)(H,19,20)(H,21,22) Key: DJSXNILVACEBLP-UHFFFAOYSA-N
SMILES OC(=O)CN(CC(O)=O)C1=C(C#N)C(CC(O)=O)=C(S1)C(O)=O C(C1=C(SC(=C1C#N)N(CC(=O)O)CC(=O)O)C(=O)O)C(=O)O
Properties
Chemical formula	C12H10N2O8S
Molar mass	342.28 g·mol^−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references

Ranelic acid is an organic acid capable of chelating metal cations.^[2]

It forms the ranelate ion, C₁₂H₆N₂O₈S⁴⁻. Strontium ranelate, the strontium salt of ranelic acid, is a drug used to treat osteoporosis and increase bone mineral density (BMD).

References

1. CID 3052774 from PubChem
2. Bivalent metal salts of 2-N,N-di(carboxymethyl)amino,3-cyano,4-carboxymethyl,5-carboxy-thiophene-acid, process for their preparation and pharmaceutical compositions containing them. EP 415850