Eudesmic acid

Eudesmic acid

Names
IUPAC name 3,4,5-trimethoxybenzoic acid
Other names 3,4,5-Trimethoxybenzoic acid Gallic acid trimethyl ether Tri-O-methylgallic acid
Identifiers
CAS Number	118-41-2
3D model (Jmol)	Interactive image
ChemSpider	8054
ECHA InfoCard	100.003.863
PubChem	8357
InChI InChI=1S/C10H12O5/c1-13-7-4-6(10(11)12)5-8(14-2)9(7)15-3/h4-5H,1-3H3,(H,11,12) Key: SJSOFNCYXJUNBT-UHFFFAOYSA-N InChI=1/C10H12O5/c1-13-7-4-6(10(11)12)5-8(14-2)9(7)15-3/h4-5H,1-3H3,(H,11,12) Key: SJSOFNCYXJUNBT-UHFFFAOYAD
SMILES COC1=CC(=CC(=C1OC)OC)C(=O)O
Properties
Chemical formula	C10H12O5
Molar mass	212.20 g·mol^−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
verify (what is  ?)
Infobox references

Eudesmic acid is an O-methylated trihydroxybenzoic acid.

Natural Occurrence

It can be found in Eucalyptus spp.^[1]

Synthesis

Eudesmic acid is most directly synthesized by reaction of gallic acid with dimethyl sulfate.^[2]

Derivatives

1. Esterified with Deanol.^[3]
2. Trimebutine
3. Amoproxan
4. Bernzamide
5. 3,4,5-trimethoxy-N-(pyridin-4-yl)benzamide [31638-97-8].^[4]
6. Butobendine
7. Capobenic acid
8. Dilazep
9. Ecipramidil
10. Fepromide
11. Hexobendine
12. Mepramidil (Diphenamilate)
13. TMB-8 [57818-92-5]
14. Tricetamide (Trimeglamide)
15. Trimethobenzamide
16. Trimetozine
17. Tritiozine (ala trimetozine but thioamide).
18. Trocimine [14368-24-2]
19. Troxipide (Lefron)
20. Troxonium
21. Troxypyrrolium (Troxypyrrole, Trox)
22. Trimetamide.
23. Vinmegallate (RGH-4417)

References

1. HPLC analysis of flavonoids and phenolic acids and aldehydes in Eucalyptus spp. E. Conde, E. Cadahía and M. C. Garcia-Vallejo, Chromatographia, Volume 41, Numbers 11-12, 657-660, doi:10.1007/BF02267800
2. Ikan, Raphael (1991). Natural Products: A Laboratory Guide 2nd Ed. San Diego: Academic Press, Inc. pp. 232–235. ISBN 0123705517.
3. Ex25 in GB 879259 
4. ES 456989